C17H21NO2S2 — CID 92502875
(2S)-1-benzylsulfonyl-2-thiophen-2-ylazepane (PubChem CID 92502875) has the molecular formula C17H21NO2S2 and a molecular weight of 335.49 g/mol. Its IUPAC name is (2S)-1-benzylsulfonyl-2-thiophen-2-ylazepane.
| Compound Name | (2S)-1-benzylsulfonyl-2-thiophen-2-ylazepane |
|---|---|
| PubChem CID | 92502875 |
| Molecular Formula | C17H21NO2S2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | (2S)-1-benzylsulfonyl-2-thiophen-2-ylazepane |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCCCC[C@H]1c1cccs1 |
| InChI | InChI=1S/C17H21NO2S2/c19-22(20,14-15-8-3-1-4-9-15)18-12-6-2-5-10-16(18)17-11-7-13-21-17/h1,3-4,7-9,11,13,16H,2,5-6,10,12,14H2/t16-/m0/s1 |
| InChIKey | DZKBZGQPDBZWRN-INIZCTEOSA-N |
| XLogP | 4.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |