C15H18N2O2S2 — CID 99817986
2-[(2S)-1-benzylsulfonylpiperidin-2-yl]-1,3-thiazole (PubChem CID 99817986) has the molecular formula C15H18N2O2S2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 2-[(2S)-1-benzylsulfonylpiperidin-2-yl]-1,3-thiazole.
| Compound Name | 2-[(2S)-1-benzylsulfonylpiperidin-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 99817986 |
| Molecular Formula | C15H18N2O2S2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 2-[(2S)-1-benzylsulfonylpiperidin-2-yl]-1,3-thiazole |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCCC[C@H]1c1nccs1 |
| InChI | InChI=1S/C15H18N2O2S2/c18-21(19,12-13-6-2-1-3-7-13)17-10-5-4-8-14(17)15-16-9-11-20-15/h1-3,6-7,9,11,14H,4-5,8,10,12H2/t14-/m0/s1 |
| InChIKey | RUPUVXVXYHVCJO-AWEZNQCLSA-N |
| XLogP | 3.20 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |