C19H22ClNO2S — CID 95079061
(2R)-1-benzylsulfonyl-2-(2-chlorophenyl)azepane (PubChem CID 95079061) has the molecular formula C19H22ClNO2S and a molecular weight of 363.91 g/mol. Its IUPAC name is (2R)-1-benzylsulfonyl-2-(2-chlorophenyl)azepane.
| Compound Name | (2R)-1-benzylsulfonyl-2-(2-chlorophenyl)azepane |
|---|---|
| PubChem CID | 95079061 |
| Molecular Formula | C19H22ClNO2S |
| Molecular Weight | 363.91 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (2R)-1-benzylsulfonyl-2-(2-chlorophenyl)azepane |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCCCC[C@@H]1c1ccccc1Cl |
| InChI | InChI=1S/C19H22ClNO2S/c20-18-12-7-6-11-17(18)19-13-5-2-8-14-21(19)24(22,23)15-16-9-3-1-4-10-16/h1,3-4,6-7,9-12,19H,2,5,8,13-15H2/t19-/m1/s1 |
| InChIKey | KQTVUQXDBNPFJX-LJQANCHMSA-N |
| XLogP | 4.79 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.91 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |