C26H35NO2S — CID 139513403
(1S)-2-benzylsulfonyl-1-cyclodecyl-3,4-dihydro-1H-isoquinoline (PubChem CID 139513403) has the molecular formula C26H35NO2S and a molecular weight of 425.64 g/mol. Its IUPAC name is (1S)-2-benzylsulfonyl-1-cyclodecyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | (1S)-2-benzylsulfonyl-1-cyclodecyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 139513403 |
| Molecular Formula | C26H35NO2S |
| Molecular Weight | 425.64 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | (1S)-2-benzylsulfonyl-1-cyclodecyl-3,4-dihydro-1H-isoquinoline |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCc2ccccc2[C@@H]1C1CCCCCCCCC1 |
| InChI | InChI=1S/C26H35NO2S/c28-30(29,21-22-13-7-6-8-14-22)27-20-19-23-15-11-12-18-25(23)26(27)24-16-9-4-2-1-3-5-10-17-24/h6-8,11-15,18,24,26H,1-5,9-10,16-17,19-21H2/t26-/m0/s1 |
| InChIKey | PHOBNJOKXIJNMP-SANMLTNESA-N |
| XLogP | 6.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.64 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |