C19H21NO2S — CID 97247505
(1R)-1-benzyl-2-cyclopropylsulfonyl-3,4-dihydro-1H-isoquinoline (PubChem CID 97247505) has the molecular formula C19H21NO2S and a molecular weight of 327.45 g/mol. Its IUPAC name is (1R)-1-benzyl-2-cyclopropylsulfonyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | (1R)-1-benzyl-2-cyclopropylsulfonyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 97247505 |
| Molecular Formula | C19H21NO2S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (1R)-1-benzyl-2-cyclopropylsulfonyl-3,4-dihydro-1H-isoquinoline |
| SMILES | O=S(=O)(C1CC1)N1CCc2ccccc2[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C19H21NO2S/c21-23(22,17-10-11-17)20-13-12-16-8-4-5-9-18(16)19(20)14-15-6-2-1-3-7-15/h1-9,17,19H,10-14H2/t19-/m1/s1 |
| InChIKey | SYHJASLMWAINTO-LJQANCHMSA-N |
| XLogP | 3.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |