C17H19NO2S — CID 153432800
(1R)-2-benzylsulfonyl-1-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 153432800) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is (1R)-2-benzylsulfonyl-1-methyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | (1R)-2-benzylsulfonyl-1-methyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 153432800 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | (1R)-2-benzylsulfonyl-1-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | C[C@@H]1c2ccccc2CCN1S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C17H19NO2S/c1-14-17-10-6-5-9-16(17)11-12-18(14)21(19,20)13-15-7-3-2-4-8-15/h2-10,14H,11-13H2,1H3/t14-/m1/s1 |
| InChIKey | RIKHLNSWTPAFQR-CQSZACIVSA-N |
| XLogP | 3.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |