C18H19NO2S — CID 134294100
(1S)-2-benzylsulfonyl-1-methyl-1,3-dihydro-2-benzazepine (PubChem CID 134294100) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is (1S)-2-benzylsulfonyl-1-methyl-1,3-dihydro-2-benzazepine.
| Compound Name | (1S)-2-benzylsulfonyl-1-methyl-1,3-dihydro-2-benzazepine |
|---|---|
| PubChem CID | 134294100 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (1S)-2-benzylsulfonyl-1-methyl-1,3-dihydro-2-benzazepine |
| SMILES | C[C@H]1c2ccccc2C=CCN1S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H19NO2S/c1-15-18-12-6-5-10-17(18)11-7-13-19(15)22(20,21)14-16-8-3-2-4-9-16/h2-12,15H,13-14H2,1H3/t15-/m0/s1 |
| InChIKey | GBNRHYTYEVJLBV-HNNXBMFYSA-N |
| XLogP | 3.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |