C14H22N2O2S — CID 110662416
4-benzylsulfonyl-1,2,6-trimethylpiperazine (PubChem CID 110662416) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 4-benzylsulfonyl-1,2,6-trimethylpiperazine.
| Compound Name | 4-benzylsulfonyl-1,2,6-trimethylpiperazine |
|---|---|
| PubChem CID | 110662416 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 4-benzylsulfonyl-1,2,6-trimethylpiperazine |
| SMILES | CC1CN(S(=O)(=O)Cc2ccccc2)CC(C)N1C |
| InChI | InChI=1S/C14H22N2O2S/c1-12-9-16(10-13(2)15(12)3)19(17,18)11-14-7-5-4-6-8-14/h4-8,12-13H,9-11H2,1-3H3 |
| InChIKey | AOMCSVFJSMTSMO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |