C12H18ClNO2S2 — CID 116815219
1-(4-chlorobutylsulfonyl)-2-thiophen-2-ylpyrrolidine (PubChem CID 116815219) has the molecular formula C12H18ClNO2S2 and a molecular weight of 307.87 g/mol. Its IUPAC name is 1-(4-chlorobutylsulfonyl)-2-thiophen-2-ylpyrrolidine.
| Compound Name | 1-(4-chlorobutylsulfonyl)-2-thiophen-2-ylpyrrolidine |
|---|---|
| PubChem CID | 116815219 |
| Molecular Formula | C12H18ClNO2S2 |
| Molecular Weight | 307.87 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 1-(4-chlorobutylsulfonyl)-2-thiophen-2-ylpyrrolidine |
| SMILES | O=S(=O)(CCCCCl)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C12H18ClNO2S2/c13-7-1-2-10-18(15,16)14-8-3-5-11(14)12-6-4-9-17-12/h4,6,9,11H,1-3,5,7-8,10H2 |
| InChIKey | XTYGYXYLSMEVAJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.87 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|