C14H22N2O3S2 — CID 51330890
2,6-dimethyl-4-(2-thiophen-2-ylpyrrolidin-1-yl)sulfonylmorpholine (PubChem CID 51330890) has the molecular formula C14H22N2O3S2 and a molecular weight of 330.48 g/mol. Its IUPAC name is 2,6-dimethyl-4-(2-thiophen-2-ylpyrrolidin-1-yl)sulfonylmorpholine.
| Compound Name | 2,6-dimethyl-4-(2-thiophen-2-ylpyrrolidin-1-yl)sulfonylmorpholine |
|---|---|
| PubChem CID | 51330890 |
| Molecular Formula | C14H22N2O3S2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 2,6-dimethyl-4-(2-thiophen-2-ylpyrrolidin-1-yl)sulfonylmorpholine |
| SMILES | CC1CN(S(=O)(=O)N2CCCC2c2cccs2)CC(C)O1 |
| InChI | InChI=1S/C14H22N2O3S2/c1-11-9-15(10-12(2)19-11)21(17,18)16-7-3-5-13(16)14-6-4-8-20-14/h4,6,8,11-13H,3,5,7,9-10H2,1-2H3 |
| InChIKey | ADRUNGUQNCBXNY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |