C21H16N8O10 — CID 5305437
ethyl 3-(2,4-dinitrophenyl)-2-[1-(2,4-dinitrophenyl)imidazol-2-yl]-2H-imidazole-1-carboxylate (PubChem CID 5305437) has the molecular formula C21H16N8O10 and a molecular weight of 540.41 g/mol. Its IUPAC name is ethyl 3-(2,4-dinitrophenyl)-2-[1-(2,4-dinitrophenyl)imidazol-2-yl]-2H-imidazole-1-carboxylate.
| Compound Name | ethyl 3-(2,4-dinitrophenyl)-2-[1-(2,4-dinitrophenyl)imidazol-2-yl]-2H-imidazole-1-carboxylate |
|---|---|
| PubChem CID | 5305437 |
| Molecular Formula | C21H16N8O10 |
| Molecular Weight | 540.41 g/mol |
| Exact Mass | 540.10 |
| IUPAC Name | ethyl 3-(2,4-dinitrophenyl)-2-[1-(2,4-dinitrophenyl)imidazol-2-yl]-2H-imidazole-1-carboxylate |
| SMILES | CCOC(=O)N1C=CN(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C1c1nccn1-c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16N8O10/c1-2-39-21(30)25-10-9-24(16-6-4-14(27(33)34)12-18(16)29(37)38)20(25)19-22-7-8-23(19)15-5-3-13(26(31)32)11-17(15)28(35)36/h3-12,20H,2H2,1H3 |
| InChIKey | BCPNTROHFZDUJZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 223.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|