C22H20N2O8 — CID 100891322
dimethyl (1R,2R,3R,6S)-3,6-bis(2-nitrophenyl)cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 100891322) has the molecular formula C22H20N2O8 and a molecular weight of 440.41 g/mol. Its IUPAC name is dimethyl (1R,2R,3R,6S)-3,6-bis(2-nitrophenyl)cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | dimethyl (1R,2R,3R,6S)-3,6-bis(2-nitrophenyl)cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 100891322 |
| Molecular Formula | C22H20N2O8 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | dimethyl (1R,2R,3R,6S)-3,6-bis(2-nitrophenyl)cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@H](C(=O)OC)[C@H](c2ccccc2[N+](=O)[O-])C=C[C@@H]1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H20N2O8/c1-31-21(25)19-15(13-7-3-5-9-17(13)23(27)28)11-12-16(20(19)22(26)32-2)14-8-4-6-10-18(14)24(29)30/h3-12,15-16,19-20H,1-2H3/t15-,16+,19-,20-/m1/s1 |
| InChIKey | CKXDGJUGYNDOKK-WOUAJJJCSA-N |
| XLogP | 3.52 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|