C17H18N2O6 — CID 123354601
5-O-methyl 3-O-(113C)methyl 2-methyl-6-(113C)methyl-4-(2-nitrophenyl)-(2,3,4,5,6-13C5)3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 123354601) has the molecular formula C17H18N2O6 and a molecular weight of 354.28 g/mol. Its IUPAC name is 5-O-methyl 3-O-(113C)methyl 2-methyl-6-(113C)methyl-4-(2-nitrophenyl)-(2,3,4,5,6-13C5)3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-methyl 3-O-(113C)methyl 2-methyl-6-(113C)methyl-4-(2-nitrophenyl)-(2,3,4,5,6-13C5)3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 123354601 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 5-O-methyl 3-O-(113C)methyl 2-methyl-6-(113C)methyl-4-(2-nitrophenyl)-(2,3,4,5,6-13C5)3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)[13C]1=[13C]([13CH3])N=[13C](C)[13CH]([13C](=O)O[13CH3])[13CH]1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N2O6/c1-9-13(16(20)24-3)15(14(10(2)18-9)17(21)25-4)11-7-5-6-8-12(11)19(22)23/h5-8,13,15H,1-4H3/i2+1,3+1,9+1,10+1,13+1,14+1,15+1,16+1 |
| InChIKey | OSUCQKNXQBPLDG-HYBOLIRGSA-N |
| XLogP | 2.39 |
| TPSA | 108.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|