C26H27N3O8 — CID 54327138
5-O-[2-(4-acetamidophenoxy)ethyl] 3-O-methyl 2,6-dimethyl-4-(2-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54327138) has the molecular formula C26H27N3O8 and a molecular weight of 509.52 g/mol. Its IUPAC name is 5-O-[2-(4-acetamidophenoxy)ethyl] 3-O-methyl 2,6-dimethyl-4-(2-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[2-(4-acetamidophenoxy)ethyl] 3-O-methyl 2,6-dimethyl-4-(2-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54327138 |
| Molecular Formula | C26H27N3O8 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 5-O-[2-(4-acetamidophenoxy)ethyl] 3-O-methyl 2,6-dimethyl-4-(2-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(C)=NC(C)=C(C(=O)OCCOc2ccc(NC(C)=O)cc2)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H27N3O8/c1-15-22(25(31)35-4)24(20-7-5-6-8-21(20)29(33)34)23(16(2)27-15)26(32)37-14-13-36-19-11-9-18(10-12-19)28-17(3)30/h5-12,22,24H,13-14H2,1-4H3,(H,28,30) |
| InChIKey | SVTHCYQRXALVKY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 146.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|