C24H26ClN3O6 — CID 54402367
5-O-[2-(2,5-dimethyl-1H-pyrrol-3-yl)ethyl] 3-O-methyl 4-(2-chloro-6-nitrophenyl)-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54402367) has the molecular formula C24H26ClN3O6 and a molecular weight of 487.94 g/mol. Its IUPAC name is 5-O-[2-(2,5-dimethyl-1H-pyrrol-3-yl)ethyl] 3-O-methyl 4-(2-chloro-6-nitrophenyl)-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[2-(2,5-dimethyl-1H-pyrrol-3-yl)ethyl] 3-O-methyl 4-(2-chloro-6-nitrophenyl)-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54402367 |
| Molecular Formula | C24H26ClN3O6 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 5-O-[2-(2,5-dimethyl-1H-pyrrol-3-yl)ethyl] 3-O-methyl 4-(2-chloro-6-nitrophenyl)-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(C)=NC(C)=C(C(=O)OCCc2cc(C)[nH]c2C)C1c1c(Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H26ClN3O6/c1-12-11-16(13(2)26-12)9-10-34-24(30)20-15(4)27-14(3)19(23(29)33-5)22(20)21-17(25)7-6-8-18(21)28(31)32/h6-8,11,19,22,26H,9-10H2,1-5H3 |
| InChIKey | VOICHSYRYRLEOL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 123.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|