C29H33Cl2N3O8 — CID 54269058
5-O-ethyl 3-O-methyl 4-(2,3-dichlorophenyl)-2-methyl-6-[2-[2-[(2-nitrophenyl)methylamino]ethoxy]ethoxymethyl]-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54269058) has the molecular formula C29H33Cl2N3O8 and a molecular weight of 622.50 g/mol. Its IUPAC name is 5-O-ethyl 3-O-methyl 4-(2,3-dichlorophenyl)-2-methyl-6-[2-[2-[(2-nitrophenyl)methylamino]ethoxy]ethoxymethyl]-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-methyl 4-(2,3-dichlorophenyl)-2-methyl-6-[2-[2-[(2-nitrophenyl)methylamino]ethoxy]ethoxymethyl]-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54269058 |
| Molecular Formula | C29H33Cl2N3O8 |
| Molecular Weight | 622.50 g/mol |
| Exact Mass | 621.16 |
| IUPAC Name | 5-O-ethyl 3-O-methyl 4-(2,3-dichlorophenyl)-2-methyl-6-[2-[2-[(2-nitrophenyl)methylamino]ethoxy]ethoxymethyl]-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(COCCOCCNCc2ccccc2[N+](=O)[O-])N=C(C)C(C(=O)OC)C1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C29H33Cl2N3O8/c1-4-42-29(36)26-22(17-41-15-14-40-13-12-32-16-19-8-5-6-11-23(19)34(37)38)33-18(2)24(28(35)39-3)25(26)20-9-7-10-21(30)27(20)31/h5-11,24-25,32H,4,12-17H2,1-3H3 |
| InChIKey | RIWBWQFZIIOCMV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|