C19H21Cl2N3O4S — CID 57039817
5-O-ethyl 3-O-methyl 6-(carbamimidoylsulfanylmethyl)-4-(2,3-dichlorophenyl)-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 57039817) has the molecular formula C19H21Cl2N3O4S and a molecular weight of 458.37 g/mol. Its IUPAC name is 5-O-ethyl 3-O-methyl 6-(carbamimidoylsulfanylmethyl)-4-(2,3-dichlorophenyl)-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-methyl 6-(carbamimidoylsulfanylmethyl)-4-(2,3-dichlorophenyl)-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 57039817 |
| Molecular Formula | C19H21Cl2N3O4S |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | 5-O-ethyl 3-O-methyl 6-(carbamimidoylsulfanylmethyl)-4-(2,3-dichlorophenyl)-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | [H]/N=C(\N)SCC1=C(C(=O)OCC)C(c2cccc(Cl)c2Cl)C(C(=O)OC)C(C)=N1 |
| InChI | InChI=1S/C19H21Cl2N3O4S/c1-4-28-18(26)15-12(8-29-19(22)23)24-9(2)13(17(25)27-3)14(15)10-6-5-7-11(20)16(10)21/h5-7,13-14H,4,8H2,1-3H3,(H3,22,23) |
| InChIKey | HICGKMYUXUGGAU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 114.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|