C21H26ClN3O5S — CID 54080638
5-O-ethyl 3-O-methyl 6-[2-(carbamothioylamino)ethoxymethyl]-4-(2-chlorophenyl)-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54080638) has the molecular formula C21H26ClN3O5S and a molecular weight of 467.98 g/mol. Its IUPAC name is 5-O-ethyl 3-O-methyl 6-[2-(carbamothioylamino)ethoxymethyl]-4-(2-chlorophenyl)-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-methyl 6-[2-(carbamothioylamino)ethoxymethyl]-4-(2-chlorophenyl)-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54080638 |
| Molecular Formula | C21H26ClN3O5S |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 5-O-ethyl 3-O-methyl 6-[2-(carbamothioylamino)ethoxymethyl]-4-(2-chlorophenyl)-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(COCCNC(N)=S)N=C(C)C(C(=O)OC)C1c1ccccc1Cl |
| InChI | InChI=1S/C21H26ClN3O5S/c1-4-30-20(27)18-15(11-29-10-9-24-21(23)31)25-12(2)16(19(26)28-3)17(18)13-7-5-6-8-14(13)22/h5-8,16-17H,4,9-11H2,1-3H3,(H3,23,24,31) |
| InChIKey | MMVXZFRLWHCYSJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|