C30H41ClN2O11 — CID 91185171
5-O-ethyl 3-O-methyl 4-(2-chlorophenyl)-6-[2-[[(3R,5R)-3,5-dihydroxyoctanoyl]oxymethoxycarbonylamino]ethoxymethyl]-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 91185171) has the molecular formula C30H41ClN2O11 and a molecular weight of 641.11 g/mol. Its IUPAC name is 5-O-ethyl 3-O-methyl 4-(2-chlorophenyl)-6-[2-[[(3R,5R)-3,5-dihydroxyoctanoyl]oxymethoxycarbonylamino]ethoxymethyl]-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-methyl 4-(2-chlorophenyl)-6-[2-[[(3R,5R)-3,5-dihydroxyoctanoyl]oxymethoxycarbonylamino]ethoxymethyl]-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 91185171 |
| Molecular Formula | C30H41ClN2O11 |
| Molecular Weight | 641.11 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | 5-O-ethyl 3-O-methyl 4-(2-chlorophenyl)-6-[2-[[(3R,5R)-3,5-dihydroxyoctanoyl]oxymethoxycarbonylamino]ethoxymethyl]-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCC[C@@H](O)C[C@@H](O)CC(=O)OCOC(=O)NCCOCC1=C(C(=O)OCC)C(c2ccccc2Cl)C(C(=O)OC)C(C)=N1 |
| InChI | InChI=1S/C30H41ClN2O11/c1-5-9-19(34)14-20(35)15-24(36)43-17-44-30(39)32-12-13-41-16-23-27(29(38)42-6-2)26(21-10-7-8-11-22(21)31)25(18(3)33-23)28(37)40-4/h7-8,10-11,19-20,25-26,34-35H,5-6,9,12-17H2,1-4H3,(H,32,39)/t19-,20-,25?,26?/m1/s1 |
| InChIKey | BVSHHUMUILDCKW-WSQGFLFRSA-N |
| XLogP | 3.05 |
| TPSA | 179.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.11 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|