C22H22Cl2N2O6 — CID 54492910
5-O-ethyl 3-O-methyl 6-[(4-amino-4-oxobut-2-ynoxy)methyl]-4-(2,3-dichlorophenyl)-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54492910) has the molecular formula C22H22Cl2N2O6 and a molecular weight of 481.33 g/mol. Its IUPAC name is 5-O-ethyl 3-O-methyl 6-[(4-amino-4-oxobut-2-ynoxy)methyl]-4-(2,3-dichlorophenyl)-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-methyl 6-[(4-amino-4-oxobut-2-ynoxy)methyl]-4-(2,3-dichlorophenyl)-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54492910 |
| Molecular Formula | C22H22Cl2N2O6 |
| Molecular Weight | 481.33 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 5-O-ethyl 3-O-methyl 6-[(4-amino-4-oxobut-2-ynoxy)methyl]-4-(2,3-dichlorophenyl)-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(COCC#CC(N)=O)N=C(C)C(C(=O)OC)C1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C22H22Cl2N2O6/c1-4-32-22(29)19-15(11-31-10-6-9-16(25)27)26-12(2)17(21(28)30-3)18(19)13-7-5-8-14(23)20(13)24/h5,7-8,17-18H,4,10-11H2,1-3H3,(H2,25,27) |
| InChIKey | XXAKQNLWRSATIS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|