C22H23Cl2NO6 — CID 54194832
5-O-ethyl 3-O-methyl 4-(2,3-dichlorophenyl)-6-(4-hydroxybut-2-ynoxymethyl)-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54194832) has the molecular formula C22H23Cl2NO6 and a molecular weight of 468.33 g/mol. Its IUPAC name is 5-O-ethyl 3-O-methyl 4-(2,3-dichlorophenyl)-6-(4-hydroxybut-2-ynoxymethyl)-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-methyl 4-(2,3-dichlorophenyl)-6-(4-hydroxybut-2-ynoxymethyl)-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54194832 |
| Molecular Formula | C22H23Cl2NO6 |
| Molecular Weight | 468.33 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | 5-O-ethyl 3-O-methyl 4-(2,3-dichlorophenyl)-6-(4-hydroxybut-2-ynoxymethyl)-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(COCC#CCO)N=C(C)C(C(=O)OC)C1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C22H23Cl2NO6/c1-4-31-22(28)19-16(12-30-11-6-5-10-26)25-13(2)17(21(27)29-3)18(19)14-8-7-9-15(23)20(14)24/h7-9,17-18,26H,4,10-12H2,1-3H3 |
| InChIKey | PLBOFAYZNDGWPK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|