C23H29N3O9 — CID 57324146
5-O-ethyl 3-O-(2-propoxyethyl) 6-(carbamoyloxymethyl)-2-methyl-4-(2-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 57324146) has the molecular formula C23H29N3O9 and a molecular weight of 491.50 g/mol. Its IUPAC name is 5-O-ethyl 3-O-(2-propoxyethyl) 6-(carbamoyloxymethyl)-2-methyl-4-(2-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-(2-propoxyethyl) 6-(carbamoyloxymethyl)-2-methyl-4-(2-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 57324146 |
| Molecular Formula | C23H29N3O9 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 5-O-ethyl 3-O-(2-propoxyethyl) 6-(carbamoyloxymethyl)-2-methyl-4-(2-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCCOCCOC(=O)C1C(C)=NC(COC(N)=O)=C(C(=O)OCC)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H29N3O9/c1-4-10-32-11-12-34-21(27)18-14(3)25-16(13-35-23(24)29)20(22(28)33-5-2)19(18)15-8-6-7-9-17(15)26(30)31/h6-9,18-19H,4-5,10-13H2,1-3H3,(H2,24,29) |
| InChIKey | BUMVQBBOMHHWPC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 169.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|