C18H20N4O4 — CID 90999871
ethyl 4-(2-nitrophenyl)-6-propyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate (PubChem CID 90999871) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is ethyl 4-(2-nitrophenyl)-6-propyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate.
| Compound Name | ethyl 4-(2-nitrophenyl)-6-propyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 90999871 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | ethyl 4-(2-nitrophenyl)-6-propyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate |
| SMILES | CCCC1=Nc2[nH]ncc2C(c2ccccc2[N+](=O)[O-])C1C(=O)OCC |
| InChI | InChI=1S/C18H20N4O4/c1-3-7-13-16(18(23)26-4-2)15(12-10-19-21-17(12)20-13)11-8-5-6-9-14(11)22(24)25/h5-6,8-10,15-16H,3-4,7H2,1-2H3,(H,19,21) |
| InChIKey | WDUYUDZQKLLXAX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 110.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|