C16H14ClN3O3 — CID 91388299
ethyl 4-(2-chlorophenyl)-6-formyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate (PubChem CID 91388299) has the molecular formula C16H14ClN3O3 and a molecular weight of 331.76 g/mol. Its IUPAC name is ethyl 4-(2-chlorophenyl)-6-formyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate.
| Compound Name | ethyl 4-(2-chlorophenyl)-6-formyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 91388299 |
| Molecular Formula | C16H14ClN3O3 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | ethyl 4-(2-chlorophenyl)-6-formyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate |
| SMILES | CCOC(=O)C1C(C=O)=Nc2[nH]ncc2C1c1ccccc1Cl |
| InChI | InChI=1S/C16H14ClN3O3/c1-2-23-16(22)14-12(8-21)19-15-10(7-18-20-15)13(14)9-5-3-4-6-11(9)17/h3-8,13-14H,2H2,1H3,(H,18,20) |
| InChIKey | JTEOPHDMHYDMMI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|