C16H14ClN5O2 — CID 90980914
4-(2-chloro-3-nitrophenyl)-6-propyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carbonitrile (PubChem CID 90980914) has the molecular formula C16H14ClN5O2 and a molecular weight of 343.77 g/mol. Its IUPAC name is 4-(2-chloro-3-nitrophenyl)-6-propyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carbonitrile.
| Compound Name | 4-(2-chloro-3-nitrophenyl)-6-propyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 90980914 |
| Molecular Formula | C16H14ClN5O2 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 4-(2-chloro-3-nitrophenyl)-6-propyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carbonitrile |
| SMILES | CCCC1=Nc2[nH]ncc2C(c2cccc([N+](=O)[O-])c2Cl)C1C#N |
| InChI | InChI=1S/C16H14ClN5O2/c1-2-4-12-10(7-18)14(11-8-19-21-16(11)20-12)9-5-3-6-13(15(9)17)22(23)24/h3,5-6,8,10,14H,2,4H2,1H3,(H,19,21) |
| InChIKey | VYMBDLWZZPRUGV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|