C25H34N4O6 — CID 57017192
diethyl 6-[2-(diethylamino)ethyliminomethyl]-2-methyl-4-(2-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 57017192) has the molecular formula C25H34N4O6 and a molecular weight of 486.57 g/mol. Its IUPAC name is diethyl 6-[2-(diethylamino)ethyliminomethyl]-2-methyl-4-(2-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 6-[2-(diethylamino)ethyliminomethyl]-2-methyl-4-(2-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 57017192 |
| Molecular Formula | C25H34N4O6 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | diethyl 6-[2-(diethylamino)ethyliminomethyl]-2-methyl-4-(2-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(/C=N/CCN(CC)CC)N=C(C)C(C(=O)OCC)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H34N4O6/c1-6-28(7-2)15-14-26-16-19-23(25(31)35-9-4)22(18-12-10-11-13-20(18)29(32)33)21(17(5)27-19)24(30)34-8-3/h10-13,16,21-22H,6-9,14-15H2,1-5H3/b26-16+ |
| InChIKey | RZOWBKZAYYAREK-WGOQTCKBSA-N |
| XLogP | 3.56 |
| TPSA | 123.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|