C18H19N3O5 — CID 57190585
5-(cyclopropylcarbamoyl)-2,6-dimethyl-4-(2-nitrophenyl)-3,4-dihydropyridine-3-carboxylic acid (PubChem CID 57190585) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is 5-(cyclopropylcarbamoyl)-2,6-dimethyl-4-(2-nitrophenyl)-3,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 5-(cyclopropylcarbamoyl)-2,6-dimethyl-4-(2-nitrophenyl)-3,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 57190585 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 5-(cyclopropylcarbamoyl)-2,6-dimethyl-4-(2-nitrophenyl)-3,4-dihydropyridine-3-carboxylic acid |
| SMILES | CC1=NC(C)=C(C(=O)NC2CC2)C(c2ccccc2[N+](=O)[O-])C1C(=O)O |
| InChI | InChI=1S/C18H19N3O5/c1-9-14(17(22)20-11-7-8-11)16(15(18(23)24)10(2)19-9)12-5-3-4-6-13(12)21(25)26/h3-6,11,15-16H,7-8H2,1-2H3,(H,20,22)(H,23,24) |
| InChIKey | PFZSFDXOMHNEBG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 121.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|