C18H19N3O5 — CID 57191182
carbamoyl 3-cyclopropyl-2,6-dimethyl-4-(2-nitrophenyl)-3,4-dihydropyridine-5-carboxylate (PubChem CID 57191182) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is carbamoyl 3-cyclopropyl-2,6-dimethyl-4-(2-nitrophenyl)-3,4-dihydropyridine-5-carboxylate.
| Compound Name | carbamoyl 3-cyclopropyl-2,6-dimethyl-4-(2-nitrophenyl)-3,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 57191182 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | carbamoyl 3-cyclopropyl-2,6-dimethyl-4-(2-nitrophenyl)-3,4-dihydropyridine-5-carboxylate |
| SMILES | CC1=NC(C)=C(C(=O)OC(N)=O)C(c2ccccc2[N+](=O)[O-])C1C1CC1 |
| InChI | InChI=1S/C18H19N3O5/c1-9-14(11-7-8-11)16(12-5-3-4-6-13(12)21(24)25)15(10(2)20-9)17(22)26-18(19)23/h3-6,11,14,16H,7-8H2,1-2H3,(H2,19,23) |
| InChIKey | FIIBQBVOXSVHPW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|