C18H19NO6 — CID 99950904
diethyl (1R,8R,9S,10S)-3-nitrotricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraene-9,10-dicarboxylate (PubChem CID 99950904) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is diethyl (1R,8R,9S,10S)-3-nitrotricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraene-9,10-dicarboxylate.
| Compound Name | diethyl (1R,8R,9S,10S)-3-nitrotricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 99950904 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | diethyl (1R,8R,9S,10S)-3-nitrotricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraene-9,10-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C(=O)OCC)[C@H]2C=C[C@H]1c1cccc([N+](=O)[O-])c12 |
| InChI | InChI=1S/C18H19NO6/c1-3-24-17(20)15-11-8-9-12(16(15)18(21)25-4-2)14-10(11)6-5-7-13(14)19(22)23/h5-9,11-12,15-16H,3-4H2,1-2H3/t11-,12-,15-,16-/m0/s1 |
| InChIKey | MTKCNYRBENZGCV-APYUEPQZSA-N |
| XLogP | 2.70 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|