C25H25NO5 — CID 98140982
diethyl (1S,8S,9R,10S)-3-benzamidotricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraene-9,10-dicarboxylate (PubChem CID 98140982) has the molecular formula C25H25NO5 and a molecular weight of 419.48 g/mol. Its IUPAC name is diethyl (1S,8S,9R,10S)-3-benzamidotricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraene-9,10-dicarboxylate.
| Compound Name | diethyl (1S,8S,9R,10S)-3-benzamidotricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 98140982 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | diethyl (1S,8S,9R,10S)-3-benzamidotricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraene-9,10-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](C(=O)OCC)[C@@H]2C=C[C@@H]1c1c(NC(=O)c3ccccc3)cccc12 |
| InChI | InChI=1S/C25H25NO5/c1-3-30-24(28)21-17-13-14-18(22(21)25(29)31-4-2)20-16(17)11-8-12-19(20)26-23(27)15-9-6-5-7-10-15/h5-14,17-18,21-22H,3-4H2,1-2H3,(H,26,27)/t17-,18-,21-,22+/m1/s1 |
| InChIKey | PNROSHKGGQSIQX-YHBROIRLSA-N |
| XLogP | 4.05 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|