C20H22N2O4 — CID 2177719
ethyl (2S)-2-[(2-benzamidobenzoyl)amino]butanoate (PubChem CID 2177719) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is ethyl (2S)-2-[(2-benzamidobenzoyl)amino]butanoate.
| Compound Name | ethyl (2S)-2-[(2-benzamidobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 2177719 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | ethyl (2S)-2-[(2-benzamidobenzoyl)amino]butanoate |
| SMILES | CCOC(=O)[C@H](CC)NC(=O)c1ccccc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O4/c1-3-16(20(25)26-4-2)21-19(24)15-12-8-9-13-17(15)22-18(23)14-10-6-5-7-11-14/h5-13,16H,3-4H2,1-2H3,(H,21,24)(H,22,23)/t16-/m0/s1 |
| InChIKey | OLSRAJHCFMRWCW-INIZCTEOSA-N |
| XLogP | 3.01 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |