C30H28N4O3 — CID 4096684
2-benzamido-N-[1-(2,2-diphenylhydrazinyl)-1-oxobutan-2-yl]benzamide (PubChem CID 4096684) has the molecular formula C30H28N4O3 and a molecular weight of 492.58 g/mol. Its IUPAC name is 2-benzamido-N-[1-(2,2-diphenylhydrazinyl)-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-benzamido-N-[1-(2,2-diphenylhydrazinyl)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 4096684 |
| Molecular Formula | C30H28N4O3 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 2-benzamido-N-[1-(2,2-diphenylhydrazinyl)-1-oxobutan-2-yl]benzamide |
| SMILES | CCC(NC(=O)c1ccccc1NC(=O)c1ccccc1)C(=O)NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H28N4O3/c1-2-26(30(37)33-34(23-16-8-4-9-17-23)24-18-10-5-11-19-24)31-29(36)25-20-12-13-21-27(25)32-28(35)22-14-6-3-7-15-22/h3-21,26H,2H2,1H3,(H,31,36)(H,32,35)(H,33,37) |
| InChIKey | SRECIUANOZRPPU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|