C12H14N2O4S — CID 98000702
ethyl (2S,4R)-2-(2-nitrophenyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 98000702) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is ethyl (2S,4R)-2-(2-nitrophenyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | ethyl (2S,4R)-2-(2-nitrophenyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 98000702 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | ethyl (2S,4R)-2-(2-nitrophenyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CS[C@@H](c2ccccc2[N+](=O)[O-])N1 |
| InChI | InChI=1S/C12H14N2O4S/c1-2-18-12(15)9-7-19-11(13-9)8-5-3-4-6-10(8)14(16)17/h3-6,9,11,13H,2,7H2,1H3/t9-,11-/m0/s1 |
| InChIKey | YTOUCUNGCSGZFG-ONGXEEELSA-N |
| XLogP | 1.86 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|