C19H25N3O6 — CID 10982047
4-O-tert-butyl 2-O-ethyl 1-amino-5-methyl-3-(2-nitrophenyl)-2,3-dihydropyrrole-2,4-dicarboxylate (PubChem CID 10982047) has the molecular formula C19H25N3O6 and a molecular weight of 391.42 g/mol. Its IUPAC name is 4-O-tert-butyl 2-O-ethyl 1-amino-5-methyl-3-(2-nitrophenyl)-2,3-dihydropyrrole-2,4-dicarboxylate.
| Compound Name | 4-O-tert-butyl 2-O-ethyl 1-amino-5-methyl-3-(2-nitrophenyl)-2,3-dihydropyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 10982047 |
| Molecular Formula | C19H25N3O6 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 4-O-tert-butyl 2-O-ethyl 1-amino-5-methyl-3-(2-nitrophenyl)-2,3-dihydropyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)C1C(c2ccccc2[N+](=O)[O-])C(C(=O)OC(C)(C)C)=C(C)N1N |
| InChI | InChI=1S/C19H25N3O6/c1-6-27-18(24)16-15(12-9-7-8-10-13(12)22(25)26)14(11(2)21(16)20)17(23)28-19(3,4)5/h7-10,15-16H,6,20H2,1-5H3 |
| InChIKey | PCDPWVNNCAOBON-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|