C15H18N2O4 — CID 130270938
tert-butyl 2-(2-nitrophenyl)-2,5-dihydropyrrole-1-carboxylate (PubChem CID 130270938) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is tert-butyl 2-(2-nitrophenyl)-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-(2-nitrophenyl)-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 130270938 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | tert-butyl 2-(2-nitrophenyl)-2,5-dihydropyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=CC1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18N2O4/c1-15(2,3)21-14(18)16-10-6-9-12(16)11-7-4-5-8-13(11)17(19)20/h4-9,12H,10H2,1-3H3 |
| InChIKey | VZPOPPVNRCBNBD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|