C10H16N2O3 — CID 77161971
tert-butyl 2-carbamoyl-2,5-dihydropyrrole-1-carboxylate (PubChem CID 77161971) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is tert-butyl 2-carbamoyl-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-carbamoyl-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 77161971 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | tert-butyl 2-carbamoyl-2,5-dihydropyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=CC1C(N)=O |
| InChI | InChI=1S/C10H16N2O3/c1-10(2,3)15-9(14)12-6-4-5-7(12)8(11)13/h4-5,7H,6H2,1-3H3,(H2,11,13) |
| InChIKey | LGJDOIHXXBPYBN-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|