C23H30N2O5 — CID 100937540
tert-butyl (2S)-2-[[(Z)-3-methyl-1-oxo-1-phenylmethoxypent-2-en-2-yl]carbamoyl]-2,5-dihydropyrrole-1-carboxylate (PubChem CID 100937540) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(Z)-3-methyl-1-oxo-1-phenylmethoxypent-2-en-2-yl]carbamoyl]-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[(Z)-3-methyl-1-oxo-1-phenylmethoxypent-2-en-2-yl]carbamoyl]-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 100937540 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | tert-butyl (2S)-2-[[(Z)-3-methyl-1-oxo-1-phenylmethoxypent-2-en-2-yl]carbamoyl]-2,5-dihydropyrrole-1-carboxylate |
| SMILES | CC/C(C)=C(\NC(=O)[C@@H]1C=CCN1C(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H30N2O5/c1-6-16(2)19(21(27)29-15-17-11-8-7-9-12-17)24-20(26)18-13-10-14-25(18)22(28)30-23(3,4)5/h7-13,18H,6,14-15H2,1-5H3,(H,24,26)/b19-16-/t18-/m0/s1 |
| InChIKey | UELLLRDWBHAKFY-ORKPOYISSA-N |
| XLogP | 3.71 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|