C28H38N2O7 — CID 15383316
tert-butyl (2S)-2-[[(E)-3-methyl-1-oxo-1-phenylmethoxypent-2-en-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]carbamoyl]-2,5-dihydropyrrole-1-carboxylate (PubChem CID 15383316) has the molecular formula C28H38N2O7 and a molecular weight of 514.62 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(E)-3-methyl-1-oxo-1-phenylmethoxypent-2-en-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]carbamoyl]-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[(E)-3-methyl-1-oxo-1-phenylmethoxypent-2-en-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]carbamoyl]-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 15383316 |
| Molecular Formula | C28H38N2O7 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | tert-butyl (2S)-2-[[(E)-3-methyl-1-oxo-1-phenylmethoxypent-2-en-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]carbamoyl]-2,5-dihydropyrrole-1-carboxylate |
| SMILES | CC/C(C)=C(\C(=O)OCc1ccccc1)N(C(=O)OC(C)(C)C)C(=O)[C@@H]1C=CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H38N2O7/c1-9-19(2)22(24(32)35-18-20-14-11-10-12-15-20)30(26(34)37-28(6,7)8)23(31)21-16-13-17-29(21)25(33)36-27(3,4)5/h10-16,21H,9,17-18H2,1-8H3/b22-19+/t21-/m0/s1 |
| InChIKey | VBSBCUYCLWHRNK-PGVNHDJNSA-N |
| XLogP | 5.35 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|