C12H19N3O3 — CID 134900698
tert-butyl (3aS,6aR)-3-carbamoyl-2,3a,6,6a-tetrahydrocyclopenta[d]imidazole-1-carboxylate (PubChem CID 134900698) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is tert-butyl (3aS,6aR)-3-carbamoyl-2,3a,6,6a-tetrahydrocyclopenta[d]imidazole-1-carboxylate.
| Compound Name | tert-butyl (3aS,6aR)-3-carbamoyl-2,3a,6,6a-tetrahydrocyclopenta[d]imidazole-1-carboxylate |
|---|---|
| PubChem CID | 134900698 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | tert-butyl (3aS,6aR)-3-carbamoyl-2,3a,6,6a-tetrahydrocyclopenta[d]imidazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CN(C(N)=O)[C@H]2C=CC[C@H]21 |
| InChI | InChI=1S/C12H19N3O3/c1-12(2,3)18-11(17)15-7-14(10(13)16)8-5-4-6-9(8)15/h4-5,8-9H,6-7H2,1-3H3,(H2,13,16)/t8-,9+/m0/s1 |
| InChIKey | QNDLKONJZSPTGL-DTWKUNHWSA-N |
| XLogP | 1.27 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|