C13H23NO2 — CID 100958735
tert-butyl (2S)-2-(2-methylpropyl)-2,5-dihydropyrrole-1-carboxylate (PubChem CID 100958735) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is tert-butyl (2S)-2-(2-methylpropyl)-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(2-methylpropyl)-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 100958735 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | tert-butyl (2S)-2-(2-methylpropyl)-2,5-dihydropyrrole-1-carboxylate |
| SMILES | CC(C)C[C@H]1C=CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23NO2/c1-10(2)9-11-7-6-8-14(11)12(15)16-13(3,4)5/h6-7,10-11H,8-9H2,1-5H3/t11-/m1/s1 |
| InChIKey | IDEODEIVQFPFBL-LLVKDONJSA-N |
| XLogP | 3.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|