C22H28N4O4 — CID 54448308
tert-butyl 1,6-dimethyl-4-(2-nitrophenyl)-3-propyl-4,5-dihydropyrazolo[5,4-b]pyridine-5-carboxylate (PubChem CID 54448308) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is tert-butyl 1,6-dimethyl-4-(2-nitrophenyl)-3-propyl-4,5-dihydropyrazolo[5,4-b]pyridine-5-carboxylate.
| Compound Name | tert-butyl 1,6-dimethyl-4-(2-nitrophenyl)-3-propyl-4,5-dihydropyrazolo[5,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 54448308 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | tert-butyl 1,6-dimethyl-4-(2-nitrophenyl)-3-propyl-4,5-dihydropyrazolo[5,4-b]pyridine-5-carboxylate |
| SMILES | CCCc1nn(C)c2c1C(c1ccccc1[N+](=O)[O-])C(C(=O)OC(C)(C)C)C(C)=N2 |
| InChI | InChI=1S/C22H28N4O4/c1-7-10-15-19-18(14-11-8-9-12-16(14)26(28)29)17(21(27)30-22(3,4)5)13(2)23-20(19)25(6)24-15/h8-9,11-12,17-18H,7,10H2,1-6H3 |
| InChIKey | WTDBVGMYTCTJTK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|