C15H17N3O6S — CID 41475439
ethyl (3S,6S)-6-[2-(2-nitroanilino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylate (PubChem CID 41475439) has the molecular formula C15H17N3O6S and a molecular weight of 367.38 g/mol. Its IUPAC name is ethyl (3S,6S)-6-[2-(2-nitroanilino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylate.
| Compound Name | ethyl (3S,6S)-6-[2-(2-nitroanilino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylate |
|---|---|
| PubChem CID | 41475439 |
| Molecular Formula | C15H17N3O6S |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | ethyl (3S,6S)-6-[2-(2-nitroanilino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CS[C@@H](CC(=O)Nc2ccccc2[N+](=O)[O-])C(=O)N1 |
| InChI | InChI=1S/C15H17N3O6S/c1-2-24-15(21)10-8-25-12(14(20)17-10)7-13(19)16-9-5-3-4-6-11(9)18(22)23/h3-6,10,12H,2,7-8H2,1H3,(H,16,19)(H,17,20)/t10-,12+/m1/s1 |
| InChIKey | HJZHUEFYVPVNKF-PWSUYJOCSA-N |
| XLogP | 1.09 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|