C14H14N3O6S- — CID 7858451
(3S,6S)-6-[2-(4-methyl-2-nitroanilino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylate (PubChem CID 7858451) has the molecular formula C14H14N3O6S- and a molecular weight of 352.35 g/mol. Its IUPAC name is (3S,6S)-6-[2-(4-methyl-2-nitroanilino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylate.
| Compound Name | (3S,6S)-6-[2-(4-methyl-2-nitroanilino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylate |
|---|---|
| PubChem CID | 7858451 |
| Molecular Formula | C14H14N3O6S- |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | (3S,6S)-6-[2-(4-methyl-2-nitroanilino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylate |
| SMILES | Cc1ccc(NC(=O)C[C@@H]2SC[C@H](C(=O)[O-])NC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H15N3O6S/c1-7-2-3-8(10(4-7)17(22)23)15-12(18)5-11-13(19)16-9(6-24-11)14(20)21/h2-4,9,11H,5-6H2,1H3,(H,15,18)(H,16,19)(H,20,21)/p-1/t9-,11+/m1/s1 |
| InChIKey | MWFISIXHUOBCLN-KOLCDFICSA-M |
| XLogP | -0.42 |
| TPSA | 141.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|