C13H13N3O6S — CID 17198316
6-[2-(4-nitroanilino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylic acid (PubChem CID 17198316) has the molecular formula C13H13N3O6S and a molecular weight of 339.33 g/mol. Its IUPAC name is 6-[2-(4-nitroanilino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylic acid.
| Compound Name | 6-[2-(4-nitroanilino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 17198316 |
| Molecular Formula | C13H13N3O6S |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 6-[2-(4-nitroanilino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylic acid |
| SMILES | O=C(CC1SCC(C(=O)O)NC1=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H13N3O6S/c17-11(14-7-1-3-8(4-2-7)16(21)22)5-10-12(18)15-9(6-23-10)13(19)20/h1-4,9-10H,5-6H2,(H,14,17)(H,15,18)(H,19,20) |
| InChIKey | ZPMYFIUAMGYTIJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|