C16H20N2O4S — CID 17190499
5-oxo-6-[2-oxo-2-(4-propan-2-ylanilino)ethyl]thiomorpholine-3-carboxylic acid (PubChem CID 17190499) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is 5-oxo-6-[2-oxo-2-(4-propan-2-ylanilino)ethyl]thiomorpholine-3-carboxylic acid.
| Compound Name | 5-oxo-6-[2-oxo-2-(4-propan-2-ylanilino)ethyl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 17190499 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 5-oxo-6-[2-oxo-2-(4-propan-2-ylanilino)ethyl]thiomorpholine-3-carboxylic acid |
| SMILES | CC(C)c1ccc(NC(=O)CC2SCC(C(=O)O)NC2=O)cc1 |
| InChI | InChI=1S/C16H20N2O4S/c1-9(2)10-3-5-11(6-4-10)17-14(19)7-13-15(20)18-12(8-23-13)16(21)22/h3-6,9,12-13H,7-8H2,1-2H3,(H,17,19)(H,18,20)(H,21,22) |
| InChIKey | YJYNNNQAERQGDP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |