C14H15N3O6S — CID 7858446
(3R,6R)-6-[2-(4-methyl-2-nitroanilino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylic acid (PubChem CID 7858446) has the molecular formula C14H15N3O6S and a molecular weight of 353.36 g/mol. Its IUPAC name is (3R,6R)-6-[2-(4-methyl-2-nitroanilino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylic acid.
| Compound Name | (3R,6R)-6-[2-(4-methyl-2-nitroanilino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 7858446 |
| Molecular Formula | C14H15N3O6S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | (3R,6R)-6-[2-(4-methyl-2-nitroanilino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylic acid |
| SMILES | Cc1ccc(NC(=O)C[C@H]2SC[C@@H](C(=O)O)NC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H15N3O6S/c1-7-2-3-8(10(4-7)17(22)23)15-12(18)5-11-13(19)16-9(6-24-11)14(20)21/h2-4,9,11H,5-6H2,1H3,(H,15,18)(H,16,19)(H,20,21)/t9-,11+/m0/s1 |
| InChIKey | MWFISIXHUOBCLN-GXSJLCMTSA-N |
| XLogP | 0.92 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|