C14H16N2O4S — CID 3158850
6-[2-(benzylamino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylic acid (PubChem CID 3158850) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is 6-[2-(benzylamino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylic acid.
| Compound Name | 6-[2-(benzylamino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 3158850 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 6-[2-(benzylamino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylic acid |
| SMILES | O=C(CC1SCC(C(=O)O)NC1=O)NCc1ccccc1 |
| InChI | InChI=1S/C14H16N2O4S/c17-12(15-7-9-4-2-1-3-5-9)6-11-13(18)16-10(8-21-11)14(19)20/h1-5,10-11H,6-8H2,(H,15,17)(H,16,18)(H,19,20) |
| InChIKey | VLPIZFYSXRGAQN-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |