C17H17N3O2 — CID 795021
N-benzyl-2-[(2R)-3-oxo-2,4-dihydro-1H-quinoxalin-2-yl]acetamide (PubChem CID 795021) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is N-benzyl-2-[(2R)-3-oxo-2,4-dihydro-1H-quinoxalin-2-yl]acetamide.
| Compound Name | N-benzyl-2-[(2R)-3-oxo-2,4-dihydro-1H-quinoxalin-2-yl]acetamide |
|---|---|
| PubChem CID | 795021 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-benzyl-2-[(2R)-3-oxo-2,4-dihydro-1H-quinoxalin-2-yl]acetamide |
| SMILES | O=C(C[C@H]1Nc2ccccc2NC1=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H17N3O2/c21-16(18-11-12-6-2-1-3-7-12)10-15-17(22)20-14-9-5-4-8-13(14)19-15/h1-9,15,19H,10-11H2,(H,18,21)(H,20,22)/t15-/m1/s1 |
| InChIKey | KDLAOUYNKLLIJE-OAHLLOKOSA-N |
| XLogP | 2.13 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |