C14H15N2O4S- — CID 6966137
(3S,6S)-6-[2-(benzylamino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylate (PubChem CID 6966137) has the molecular formula C14H15N2O4S- and a molecular weight of 307.35 g/mol. Its IUPAC name is (3S,6S)-6-[2-(benzylamino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylate.
| Compound Name | (3S,6S)-6-[2-(benzylamino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylate |
|---|---|
| PubChem CID | 6966137 |
| Molecular Formula | C14H15N2O4S- |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | (3S,6S)-6-[2-(benzylamino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylate |
| SMILES | O=C(C[C@@H]1SC[C@H](C(=O)[O-])NC1=O)NCc1ccccc1 |
| InChI | InChI=1S/C14H16N2O4S/c17-12(15-7-9-4-2-1-3-5-9)6-11-13(18)16-10(8-21-11)14(19)20/h1-5,10-11H,6-8H2,(H,15,17)(H,16,18)(H,19,20)/p-1/t10-,11+/m1/s1 |
| InChIKey | VLPIZFYSXRGAQN-MNOVXSKESA-M |
| XLogP | -0.96 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |