C16H19NO6 — CID 118151823
methyl (2S,3R)-2-(2-nitrophenyl)-1,4-dioxaspiro[4.5]decane-3-carboxylate (PubChem CID 118151823) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is methyl (2S,3R)-2-(2-nitrophenyl)-1,4-dioxaspiro[4.5]decane-3-carboxylate.
| Compound Name | methyl (2S,3R)-2-(2-nitrophenyl)-1,4-dioxaspiro[4.5]decane-3-carboxylate |
|---|---|
| PubChem CID | 118151823 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | methyl (2S,3R)-2-(2-nitrophenyl)-1,4-dioxaspiro[4.5]decane-3-carboxylate |
| SMILES | COC(=O)[C@@H]1OC2(CCCCC2)O[C@H]1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19NO6/c1-21-15(18)14-13(11-7-3-4-8-12(11)17(19)20)22-16(23-14)9-5-2-6-10-16/h3-4,7-8,13-14H,2,5-6,9-10H2,1H3/t13-,14+/m0/s1 |
| InChIKey | GGRGZMHKBFAKGS-UONOGXRCSA-N |
| XLogP | 2.88 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|